CAS 1803584-20-4 appears in our catalog under these names: 2-(3,5-Dichlorophenyl)prop-2-enenitrile, 95%, 2-(3,5-Dichlorophenyl)prop-2-enenitrile. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-(3,5-dichlorophenyl)prop-2-enenitrile (CAS 1803584-20-4) is a chemical compound with the molecular formula C9H5Cl2N and a molecular weight of 198.05 g/mol. IUPAC name: 2-(3,5-dichlorophenyl)prop-2-enenitrile. InChIKey: PGOZVYFFLRLPSE-UHFFFAOYSA-N.
| Molecular formula | C9H5Cl2N |
|---|---|
| Molecular weight | 198.05 g/mol |
| IUPAC name | 2-(3,5-dichlorophenyl)prop-2-enenitrile |
| InChIKey | PGOZVYFFLRLPSE-UHFFFAOYSA-N |
| SMILES | C=C(C#N)C1=CC(=CC(=C1)Cl)Cl |
Computed by PubChem (NCBI)