CAS 21617-12-9 appears in our catalog under these names: Hydroxychloroquine Impurity 11, Hydroxychloroquine Impurity 6, 4,8-Dichloroquinoline, >95% (HPLC), 4,8–Dichloroquinoline, 4,8-Dichloroquinoline, >98.0%(GC). Offered by: Chemat Brand, TRC, GLPBio, TCI, Chemat. Available pack sizes: on request, 100mg, 500mg, 50mg, 10g, 1g, 5g, 250mg.
4,8-dichloroquinoline (CAS 21617-12-9) is a chemical compound with the molecular formula C9H5Cl2N and a molecular weight of 198.05 g/mol. IUPAC name: 4,8-dichloroquinoline. InChIKey: SDPCOMBBZFETLG-UHFFFAOYSA-N.
| Molecular formula | C9H5Cl2N |
|---|---|
| Molecular weight | 198.05 g/mol |
| IUPAC name | 4,8-dichloroquinoline |
| InChIKey | SDPCOMBBZFETLG-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CN=C2C(=C1)Cl)Cl |
Computed by PubChem (NCBI)