Products 2377610-17-6
CAS 2377610-17-6 is the registry number for 3-Chloro-2,5-difluorophenylboronic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
(3-chloro-2,5-difluorophenyl)boronic acid (CAS 2377610-17-6) is a chemical compound with the molecular formula C6H4BClF2O2 and a molecular weight of 192.36 g/mol. IUPAC name: (3-chloro-2,5-difluorophenyl)boronic acid. InChIKey: FUEJTTZXXILONA-UHFFFAOYSA-N.
| Molecular formula | C6H4BClF2O2 |
|---|---|
| Molecular weight | 192.36 g/mol |
| IUPAC name | (3-chloro-2,5-difluorophenyl)boronic acid |
| InChIKey | FUEJTTZXXILONA-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1F)Cl)F)(O)O |
Computed by PubChem (NCBI)