CAS 366495-92-3 appears in our catalog under these names: 4,7-Dichloroquinoline-15N, >95% (HPLC), 4,7-Dichloroquinoline-15N, 99 atom % 15N, min 98% Chemical Purity, 4,7-Dichloroquinoline-15N. Offered by: TRC, CDN, MedChemExpress. Available pack sizes: 10mg, 1mg, 2mg, 0,1g, 1 mg, 2 mg, 10 mg.
4,7-dichloroquinoline (CAS 366495-92-3) is a chemical compound with the molecular formula C9H5Cl2N and a molecular weight of 199.04 g/mol. IUPAC name: 4,7-dichloroquinoline. InChIKey: HXEWMTXDBOQQKO-HNHCFKFXSA-N.
| Molecular formula | C9H5Cl2N |
|---|---|
| Molecular weight | 199.04 g/mol |
| IUPAC name | 4,7-dichloroquinoline |
| InChIKey | HXEWMTXDBOQQKO-HNHCFKFXSA-N |
| SMILES | C1=CC2=C(C=C[15N]=C2C=C1Cl)Cl |
Computed by PubChem (NCBI)