CAS 4203-18-3 appears in our catalog under these names: 4,6-Dichloroquinoline, 4,6–Dichloroquinoline, 4,6-Dichloroquinoline, >98.0%(GC), 4,6-Dichloroquinoline 98%, 4,6-Dichloroquinoline, 98%. Offered by: Chemat Brand, GLPBio, Biosynth, TCI, Ambeed. Available pack sizes: on request, 1g, 250mg, 5g, 10g, 25g.
4,6-dichloroquinoline (CAS 4203-18-3) is a chemical compound with the molecular formula C9H5Cl2N and a molecular weight of 198.05 g/mol. IUPAC name: 4,6-dichloroquinoline. InChIKey: JZGUMSTXLPEMFW-UHFFFAOYSA-N.
| Molecular formula | C9H5Cl2N |
|---|---|
| Molecular weight | 198.05 g/mol |
| IUPAC name | 4,6-dichloroquinoline |
| InChIKey | JZGUMSTXLPEMFW-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC=CC(=C2C=C1Cl)Cl |
Computed by PubChem (NCBI)