Products 53553-15-4
CAS 53553-15-4 is the registry number for Methyl 3-amino-2-chlorobenzoate hydrochloride. Offered by: Biosynth. Available pack sizes: 5g.
Methyl 3-amino-2-chlorobenzoate;hydrochloride (CAS 53553-15-4) is a chemical compound with the molecular formula C8H9Cl2NO2 and a molecular weight of 222.07 g/mol. IUPAC name: methyl 3-amino-2-chlorobenzoate;hydrochloride. InChIKey: QTECUMBUQUXCIO-UHFFFAOYSA-N.
| Molecular formula | C8H9Cl2NO2 |
|---|---|
| Molecular weight | 222.07 g/mol |
| IUPAC name | methyl 3-amino-2-chlorobenzoate;hydrochloride |
| InChIKey | QTECUMBUQUXCIO-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=CC=C1)N)Cl.Cl |
Computed by PubChem (NCBI)