CAS 703-61-7 appears in our catalog under these names: 2,4-Dichloroquinoline, >95% (HPLC), 2,4-Dichloroquinoline, 2,4-Dichloroquinoline, >98.0%(GC), 2,4-Dichloroquinoline 98%, 2,4-Dichloroquinoline, 95%. Offered by: TRC, Biosynth, TCI, Ambeed, Fluorochem. Available pack sizes: 1g, 25g, 5g, 2g, 10g, 100g, 500g.
2,4-dichloroquinoline (CAS 703-61-7) is a chemical compound with the molecular formula C9H5Cl2N and a molecular weight of 198.05 g/mol. IUPAC name: 2,4-dichloroquinoline. InChIKey: QNBJYUUUYZVIJP-UHFFFAOYSA-N.
| Molecular formula | C9H5Cl2N |
|---|---|
| Molecular weight | 198.05 g/mol |
| IUPAC name | 2,4-dichloroquinoline |
| InChIKey | QNBJYUUUYZVIJP-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC(=N2)Cl)Cl |
Computed by PubChem (NCBI)