CAS 70810-23-0 appears in our catalog under these names: 1,5–Dichloroisoquinoline, 1,5-Dichloroisoquinoline 97%, 1,5-Dichloroisoquinoline, 97%, 97%, 1,5-Dichloroisoquinoline, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg.
1,5-dichloroisoquinoline (CAS 70810-23-0) is a chemical compound with the molecular formula C9H5Cl2N and a molecular weight of 198.05 g/mol. IUPAC name: 1,5-dichloroisoquinoline. InChIKey: IKLNCVLTIQMRDB-UHFFFAOYSA-N.
| Molecular formula | C9H5Cl2N |
|---|---|
| Molecular weight | 198.05 g/mol |
| IUPAC name | 1,5-dichloroisoquinoline |
| InChIKey | IKLNCVLTIQMRDB-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CN=C2Cl)C(=C1)Cl |
Computed by PubChem (NCBI)