CAS 7742-73-6 appears in our catalog under these names: 1,3-Dichloroisoquinoline, >98.0%(GC), 1,3-Dichloroisoquinoline, 97%, 1,3-Dichloroisoquinoline 98%, 1,3-Dichloroisoquinoline, 98%, 98%, 1,3-Dichloroisoquinoline, 99.95%. Offered by: TCI, Thermo Scientific (Acros), Ambeed, Chemat, Sigma-Aldrich. Available pack sizes: 1g, 5g, 250mg, 10g, 25g, 100g, 500g, 50g.
1,3-dichloroisoquinoline (CAS 7742-73-6) is a chemical compound with the molecular formula C9H5Cl2N and a molecular weight of 198.05 g/mol. IUPAC name: 1,3-dichloroisoquinoline. InChIKey: BRGZEQXWZWBPJH-UHFFFAOYSA-N.
| Molecular formula | C9H5Cl2N |
|---|---|
| Molecular weight | 198.05 g/mol |
| IUPAC name | 1,3-dichloroisoquinoline |
| InChIKey | BRGZEQXWZWBPJH-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(N=C2Cl)Cl |
Computed by PubChem (NCBI)