CAS 78583-86-5 appears in our catalog under these names: 3-Chloro-3-(4-chlorophenyl)acrylonitrile, 97%, 3-Chloro-3-(4-chlorophenyl)acrylonitrile. Offered by: AmBeed, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 25g.
(Z)-3-chloro-3-(4-chlorophenyl)prop-2-enenitrile (CAS 78583-86-5) is a chemical compound with the molecular formula C9H5Cl2N and a molecular weight of 198.05 g/mol. IUPAC name: (Z)-3-chloro-3-(4-chlorophenyl)prop-2-enenitrile. InChIKey: HAOPARUBVPVOCT-UITAMQMPSA-N.
| Molecular formula | C9H5Cl2N |
|---|---|
| Molecular weight | 198.05 g/mol |
| IUPAC name | (Z)-3-chloro-3-(4-chlorophenyl)prop-2-enenitrile |
| InChIKey | HAOPARUBVPVOCT-UITAMQMPSA-N |
| SMILES | C1=CC(=CC=C1/C(=C/C#N)/Cl)Cl |
Computed by PubChem (NCBI)