Products 83-64-7
CAS 83-64-7 is the registry number for 8-Amino-1-naphthol-5-sulfonic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-amino-5-hydroxynaphthalene-1-sulfonic acid (CAS 83-64-7) is a chemical compound with the molecular formula C10H9NO4S and a molecular weight of 239.25 g/mol. IUPAC name: 4-amino-5-hydroxynaphthalene-1-sulfonic acid. InChIKey: LRDIEHDJWYRVPT-UHFFFAOYSA-N.
| Molecular formula | C10H9NO4S |
|---|---|
| Molecular weight | 239.25 g/mol |
| IUPAC name | 4-amino-5-hydroxynaphthalene-1-sulfonic acid |
| InChIKey | LRDIEHDJWYRVPT-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2C(=C1)O)N)S(=O)(=O)O |
Computed by PubChem (NCBI)
Synonyms:
S acid, 4-Amino-5-hydroxy-1-naphthalenesulfonic acid, Chicago acid S, Kyselina S, Kyselina S [Czech], Aminonaphtholsulfonic acid S, Aminonaphthol sulfonic acid S, Kyselina 1-amino-8-naftol-4-sulfonova, 4-Amino-5-hydroxynaphthalene-1-sulphonic acid, Kyselina 1-amino-8-naftol-4-sulfonova [Czech]