CAS 911645-24-4 appears in our catalog under these names: 5–Chloro–2,4–difluorophenylboronic acid, (5-Chloro-2,4-difluorophenyl)boronic acid, 95%, 95%, (5-Chloro-2,4-difluorophenyl)boronic acid, 95%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg, 10g.
(5-chloro-2,4-difluorophenyl)boronic acid (CAS 911645-24-4) is a chemical compound with the molecular formula C6H4BClF2O2 and a molecular weight of 192.36 g/mol. IUPAC name: (5-chloro-2,4-difluorophenyl)boronic acid. InChIKey: NEZHJPAWXWRHBO-UHFFFAOYSA-N.
| Molecular formula | C6H4BClF2O2 |
|---|---|
| Molecular weight | 192.36 g/mol |
| IUPAC name | (5-chloro-2,4-difluorophenyl)boronic acid |
| InChIKey | NEZHJPAWXWRHBO-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1F)F)Cl)(O)O |
Computed by PubChem (NCBI)