Products 951306-53-9
CAS 951306-53-9 is the registry number for Methyl 6-(chloromethyl)pyridine-3-carboxylate hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 5g.
Methyl 6-(chloromethyl)pyridine-3-carboxylate;hydrochloride (CAS 951306-53-9) is a chemical compound with the molecular formula C8H9Cl2NO2 and a molecular weight of 222.07 g/mol. IUPAC name: methyl 6-(chloromethyl)pyridine-3-carboxylate;hydrochloride. InChIKey: BFJOWKDRJQVNOR-UHFFFAOYSA-N.
| Molecular formula | C8H9Cl2NO2 |
|---|---|
| Molecular weight | 222.07 g/mol |
| IUPAC name | methyl 6-(chloromethyl)pyridine-3-carboxylate;hydrochloride |
| InChIKey | BFJOWKDRJQVNOR-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CN=C(C=C1)CCl.Cl |
Computed by PubChem (NCBI)