(2,6-Difluoro-3-hydroxyphenyl)boronic acid, 97%
cas: 957065-86-0 — see every product listed under this CAS number, including other names
(2,6-Difluoro-3-hydroxyphenyl)boronic acid, 97% (CAS 957065-86-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 10g. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A265828-250mg |
| cas | 957065-86-0 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 131.19 Pln | |
| Ambeed | 1g | 153.44 Pln | |
| Ambeed | 5g | 403.75 Pln | |
| Ambeed | 25g | 1594.12 Pln | |
| BLDpharm | 250mg | 131.09 Pln | |
| BLDpharm | 1g | 158.86 Pln | |
| BLDpharm | 5g | 430.98 Pln | |
| BLDpharm | 25g | 1713.87 Pln | |
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 1g | 122.00 Pln | |
| Chemat | 5g | 304.40 Pln | |
| Chemat | 10g | 539.60 Pln | |
| Chemat | 25g | 1235.60 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
(2,6-difluoro-3-hydroxyphenyl)boronic acid (CAS 957065-86-0) is a chemical compound with the molecular formula C6H5BF2O3 and a molecular weight of 173.91 g/mol. IUPAC name: (2,6-difluoro-3-hydroxyphenyl)boronic acid. InChIKey: YTKYZCCDBZCCOK-UHFFFAOYSA-N.
| Molecular formula | C6H5BF2O3 |
|---|---|
| Molecular weight | 173.91 g/mol |
| IUPAC name | (2,6-difluoro-3-hydroxyphenyl)boronic acid |
| InChIKey | YTKYZCCDBZCCOK-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1F)O)F)(O)O |
Computed by PubChem (NCBI)
Synonyms:
2,6-Difluoro-3-hydroxybenzeneboronic acid, 2,6-Difluoro-3-hydroxyphenylboronic acid, (2,6-difluoro-3-hydroxyphenyl)boronic acid, 2,6-Difluoro-5-hydroxyphenylboronic acid, (2,6-difluoro-3-hydroxy-phenyl)boronic acid, Boronic acid,B-(2,6-difluoro-3-hydroxyphenyl)-, (2,6-Difluoro-3-hydroxyphenyl)boronicacid, 2,6-difluoro-3-hydroxy-phenyl boronic acid, YTKYZCCDBZCCOK-UHFFFAOYSA-N, Boronic acid,B-(2,6-difluoro-3-hyd
