Products 1310403-94-1
CAS 1310403-94-1 appears in our catalog under these names: (4-Ethoxy-2,6-difluorophenyl)boronic acid, 97%, 2,6-Difluoro-4-ethoxyphenylboronic acid, 97%. Offered by: Fluorochem, Ambeed, Chemat. Available pack sizes: 1g, 5g, 250mg.
(4-ethoxy-2,6-difluorophenyl)boronic acid (CAS 1310403-94-1) is a chemical compound with the molecular formula C8H9BF2O3 and a molecular weight of 201.97 g/mol. IUPAC name: (4-ethoxy-2,6-difluorophenyl)boronic acid. InChIKey: MCHIBZJJQDCWMG-UHFFFAOYSA-N.
| Molecular formula | C8H9BF2O3 |
|---|---|
| Molecular weight | 201.97 g/mol |
| IUPAC name | (4-ethoxy-2,6-difluorophenyl)boronic acid |
| InChIKey | MCHIBZJJQDCWMG-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1F)OCC)F)(O)O |
Computed by PubChem (NCBI)