Products 849062-00-6
CAS 849062-00-6 appears in our catalog under these names: 2,6–Difluoro–3–ethoxyphenylboronic acid(contains varying amounts of Anhydride), 3-Ethoxy-2,6-difluorophenylboronic Acid (contains varying amounts of Anhydride), 2,6-Difluoro-3-ethoxyphenylboronic acid, 98%. Offered by: GLPBio, TCI, Fluorochem. Available pack sizes: 1g, 5g, 25g.
(3-ethoxy-2,6-difluorophenyl)boronic acid (CAS 849062-00-6) is a chemical compound with the molecular formula C8H9BF2O3 and a molecular weight of 201.97 g/mol. IUPAC name: (3-ethoxy-2,6-difluorophenyl)boronic acid. InChIKey: XNCPAOSJJNRPHW-UHFFFAOYSA-N.
| Molecular formula | C8H9BF2O3 |
|---|---|
| Molecular weight | 201.97 g/mol |
| IUPAC name | (3-ethoxy-2,6-difluorophenyl)boronic acid |
| InChIKey | XNCPAOSJJNRPHW-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1F)OCC)F)(O)O |
Computed by PubChem (NCBI)
Synonyms:
2,6-Difluoro-3-ethoxyphenylboronic acid, (3-ethoxy-2,6-difluorophenyl)boronic acid, 2,6-Difluoro-5-ethoxyphenylboronic acid, (3-ethoxy-2,6-difluoro-phenyl)boronic acid, 2,6-Difluoro-3-ethoxyphenylboronic acid(contains varying amounts of Anhydride), 3-Ethoxy-2,6-difluorophenylboronic Acid (contains varying amounts of Anhydride), XNCPAOSJJNRPHW-UHFFFAOYSA-N, 2,6-Difluoro-3-ethoxyphenylboronicacid, 2,6-difluoro-3-ethoxyphenyl-boronic acid, 3-ethoxy-2,6-difluoro-phenylboronic acid