CAS 1452575-83-5 appears in our catalog under these names: (4-Ethoxy-2,5-difluorophenyl)boronic acid, 95+%, 95+%, (4-Ethoxy-2,5-difluorophenyl)boronic acid, 95+%. Offered by: Chemat, Fluorochem. Available pack sizes: 250mg, 1g.
(4-ethoxy-2,5-difluorophenyl)boronic acid (CAS 1452575-83-5) is a chemical compound with the molecular formula C8H9BF2O3 and a molecular weight of 201.97 g/mol. IUPAC name: (4-ethoxy-2,5-difluorophenyl)boronic acid. InChIKey: MCHGZBKHWUZZTJ-UHFFFAOYSA-N.
| Molecular formula | C8H9BF2O3 |
|---|---|
| Molecular weight | 201.97 g/mol |
| IUPAC name | (4-ethoxy-2,5-difluorophenyl)boronic acid |
| InChIKey | MCHGZBKHWUZZTJ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1F)OCC)F)(O)O |
Computed by PubChem (NCBI)