cas: 1498333-87-1 — see every product listed under this CAS number, including other names
(4-(Pyridin-2-yl)phenyl)methanamine hydrochloride 95% (CAS 1498333-87-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A174077-100mg |
| cas | 1498333-87-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 175.69 Pln | |
| Ambeed | 250mg | 186.81 Pln | |
| Ambeed | 1g | 220.19 Pln | |
| Ambeed | 5g | 809.81 Pln | |
| Ambeed | 10g | 1538.50 Pln | |
| Ambeed | 25g | 3724.56 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A174077 |
(4-pyridin-2-ylphenyl)methanamine;hydrochloride (CAS 1498333-87-1) is a chemical compound with the molecular formula C12H13ClN2 and a molecular weight of 220.70 g/mol. IUPAC name: (4-pyridin-2-ylphenyl)methanamine;hydrochloride. InChIKey: CIJJNYGBSSBMHU-UHFFFAOYSA-N.
| Molecular formula | C12H13ClN2 |
|---|---|
| Molecular weight | 220.70 g/mol |
| IUPAC name | (4-pyridin-2-ylphenyl)methanamine;hydrochloride |
| InChIKey | CIJJNYGBSSBMHU-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C2=CC=C(C=C2)CN.Cl |
Computed by PubChem (NCBI)