(4-Ethoxy-2,5-difluorophenyl)boronic acid, 95+%
cas: 1452575-83-5 — see every product listed under this CAS number, including other names
(4-Ethoxy-2,5-difluorophenyl)boronic acid, 95+% (CAS 1452575-83-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A274571-250mg |
| cas | 1452575-83-5 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 337.00 Pln | |
| Ambeed | 1g | 442.69 Pln | |
| Ambeed | 5g | 1421.69 Pln | |
| Chemat | 250mg | 381.20 Pln | |
| Chemat | 1g | 923.60 Pln | |
| BLDpharm | 250mg | 353.23 Pln | |
| BLDpharm | 1g | 469.86 Pln | |
| BLDpharm | 5g | 1525.04 Pln | |
| Fluorochem | 250mg | 695.61 Pln | |
| Fluorochem | 1g | 1700.46 Pln |
properties
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
(4-ethoxy-2,5-difluorophenyl)boronic acid (CAS 1452575-83-5) is a chemical compound with the molecular formula C8H9BF2O3 and a molecular weight of 201.97 g/mol. IUPAC name: (4-ethoxy-2,5-difluorophenyl)boronic acid. InChIKey: MCHGZBKHWUZZTJ-UHFFFAOYSA-N.
| Molecular formula | C8H9BF2O3 |
|---|---|
| Molecular weight | 201.97 g/mol |
| IUPAC name | (4-ethoxy-2,5-difluorophenyl)boronic acid |
| InChIKey | MCHGZBKHWUZZTJ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1F)OCC)F)(O)O |
Computed by PubChem (NCBI)