cas: 13590-42-6 — see every product listed under this CAS number, including other names
(S)-Benzyl 2-(2,5-dioxooxazolidin-4-yl)acetate 97% (CAS 13590-42-6) is a chemical reagent available from Chemat. Available pack sizes: 500g, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A663741-500g |
| cas | 13590-42-6 |
| size | 500g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 500g | 9287.06 Pln | |
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 292.50 Pln | |
| Ambeed | 10g | 481.62 Pln | |
| Ambeed | 25g | 776.44 Pln | |
| Ambeed | 100g | 2372.88 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A663741 |
Benzyl 2-[(4S)-2,5-dioxo-1,3-oxazolidin-4-yl]acetate (CAS 13590-42-6) is a chemical compound with the molecular formula C12H11NO5 and a molecular weight of 249.22 g/mol. IUPAC name: benzyl 2-[(4S)-2,5-dioxo-1,3-oxazolidin-4-yl]acetate. InChIKey: QNIPTEJAZIWFHH-VIFPVBQESA-N.
| Molecular formula | C12H11NO5 |
|---|---|
| Molecular weight | 249.22 g/mol |
| IUPAC name | benzyl 2-[(4S)-2,5-dioxo-1,3-oxazolidin-4-yl]acetate |
| InChIKey | QNIPTEJAZIWFHH-VIFPVBQESA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)C[C@H]2C(=O)OC(=O)N2 |
Computed by PubChem (NCBI)