cas: 630421-73-7 — see every product listed under this CAS number, including other names
1,6-Dichloroisoquinoline 97% (CAS 630421-73-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A503495-100mg |
| cas | 630421-73-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 147.88 Pln | |
| Ambeed | 250mg | 164.56 Pln | |
| Ambeed | 1g | 186.81 Pln | |
| Ambeed | 5g | 292.50 Pln | |
| Ambeed | 10g | 503.88 Pln | |
| Ambeed | 25g | 1138.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A503495 |
1,6-dichloroisoquinoline (CAS 630421-73-7) is a chemical compound with the molecular formula C9H5Cl2N and a molecular weight of 198.05 g/mol. IUPAC name: 1,6-dichloroisoquinoline. InChIKey: JTCCQIDTKFGEQY-UHFFFAOYSA-N.
| Molecular formula | C9H5Cl2N |
|---|---|
| Molecular weight | 198.05 g/mol |
| IUPAC name | 1,6-dichloroisoquinoline |
| InChIKey | JTCCQIDTKFGEQY-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CN=C2Cl)C=C1Cl |
Computed by PubChem (NCBI)