2,3-DIFLUORO-4-NITROBENZOIC ACID, 98%
cas: 1806370-35-3 — see every product listed under this CAS number, including other names
2,3-DIFLUORO-4-NITROBENZOIC ACID, 98% (CAS 1806370-35-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100mg. Offered by: Fluorochem, Ambeed, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F386314-250MG |
| cas | 1806370-35-3 |
| size | 250mg |
| availability | In Stock Germany |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 232.23 Pln | |
| Fluorochem | 1g | 508.17 Pln | |
| Fluorochem | 5g | 1580.71 Pln | |
| Fluorochem | 10g | 2741.76 Pln | |
| Fluorochem | 25g | 5381.46 Pln | |
| Ambeed | 100mg | 186.81 Pln | |
| Ambeed | 250mg | 231.31 Pln | |
| Ambeed | 1g | 492.75 Pln | |
| Ambeed | 5g | 1527.38 Pln | |
| Chemat | 100mg | 126.80 Pln | |
| Chemat | 250mg | 179.60 Pln | |
| Chemat | 1g | 395.60 Pln |
properties
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 5-10 days |
| category | Odczynniki chemiczne |
2,3-difluoro-4-nitrobenzoic acid (CAS 1806370-35-3) is a chemical compound with the molecular formula C7H3F2NO4 and a molecular weight of 203.10 g/mol. IUPAC name: 2,3-difluoro-4-nitrobenzoic acid. InChIKey: MNVKJEDUWUEZEQ-UHFFFAOYSA-N.
| Molecular formula | C7H3F2NO4 |
|---|---|
| Molecular weight | 203.10 g/mol |
| IUPAC name | 2,3-difluoro-4-nitrobenzoic acid |
| InChIKey | MNVKJEDUWUEZEQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C(=O)O)F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)