cas: 1806370-35-3 — see every product listed under this CAS number, including other names
2,3-DIFLUORO-4-NITROBENZOIC ACID, 98% (CAS 1806370-35-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F386314-250MG |
| cas | 1806370-35-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 221.81 Pln | |
| Fluorochem | 1g | 529.00 Pln | |
| Fluorochem | 5g | 1502.61 Pln | |
| Fluorochem | 10g | 2632.42 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
2,3-difluoro-4-nitrobenzoic acid (CAS 1806370-35-3) is a chemical compound with the molecular formula C7H3F2NO4 and a molecular weight of 203.10 g/mol. IUPAC name: 2,3-difluoro-4-nitrobenzoic acid. InChIKey: MNVKJEDUWUEZEQ-UHFFFAOYSA-N.
| Molecular formula | C7H3F2NO4 |
|---|---|
| Molecular weight | 203.10 g/mol |
| IUPAC name | 2,3-difluoro-4-nitrobenzoic acid |
| InChIKey | MNVKJEDUWUEZEQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C(=O)O)F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)