CAS 331765-71-0 appears in our catalog under these names: 3,5–Difluoro–2–nitrobenzoic acid, 3,5-Difluoro-2-nitrobenzoic acid, 3,5-Difluoro-2-nitrobenzoic acid 96%, 3,5-Difluoro-2-nitrobenzoic acid, 96%, 96%, 3,5-Difluoro-2-nitrobenzoic acid, 96%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 5g, 250mg.
3,5-difluoro-2-nitrobenzoic acid (CAS 331765-71-0) is a chemical compound with the molecular formula C7H3F2NO4 and a molecular weight of 203.10 g/mol. IUPAC name: 3,5-difluoro-2-nitrobenzoic acid. InChIKey: ZBEWIPTYUHHZIS-UHFFFAOYSA-N.
| Molecular formula | C7H3F2NO4 |
|---|---|
| Molecular weight | 203.10 g/mol |
| IUPAC name | 3,5-difluoro-2-nitrobenzoic acid |
| InChIKey | ZBEWIPTYUHHZIS-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(=O)O)[N+](=O)[O-])F)F |
Computed by PubChem (NCBI)