Products 1645-96-1

CAS 1645-96-1 appears in our catalog under these names: 2,2-Difluoro-5-nitrobenzo(d)(1,3)dioxole, 98%, 2,2–Difluoro–5–nitrobenzo(d)(1,3)dioxole, 2,2-Difluoro-5-nitrobenzo[d][1,3]dioxole, 98%. Offered by: AmBeed, GLPBio, Fluorochem. Available pack sizes: 1g, 5g, 10g, 25g.

2,2-difluoro-5-nitro-1,3-benzodioxole (CAS 1645-96-1) is a chemical compound with the molecular formula C7H3F2NO4 and a molecular weight of 203.10 g/mol. IUPAC name: 2,2-difluoro-5-nitro-1,3-benzodioxole. InChIKey: YCLXTFDBDIYVPZ-UHFFFAOYSA-N.

Identity
Molecular formulaC7H3F2NO4
Molecular weight203.10 g/mol
IUPAC name2,2-difluoro-5-nitro-1,3-benzodioxole
InChIKeyYCLXTFDBDIYVPZ-UHFFFAOYSA-N
SMILESC1=CC2=C(C=C1[N+](=O)[O-])OC(O2)(F)F

Computed by PubChem (NCBI)