CAS 1546229-03-1 is the registry number for 2,2-Difluoro-[1,3]dioxolo[4,5-c]pyridine-6-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2,2-difluoro-[1,3]dioxolo[4,5-c]pyridine-6-carboxylic acid (CAS 1546229-03-1) is a chemical compound with the molecular formula C7H3F2NO4 and a molecular weight of 203.10 g/mol. IUPAC name: 2,2-difluoro-[1,3]dioxolo[4,5-c]pyridine-6-carboxylic acid. InChIKey: MNAKSVAJYDJDEE-UHFFFAOYSA-N.
| Molecular formula | C7H3F2NO4 |
|---|---|
| Molecular weight | 203.10 g/mol |
| IUPAC name | 2,2-difluoro-[1,3]dioxolo[4,5-c]pyridine-6-carboxylic acid |
| InChIKey | MNAKSVAJYDJDEE-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CN=C1C(=O)O)OC(O2)(F)F |
Computed by PubChem (NCBI)