cas: 1000566-17-5 — see every product listed under this CAS number, including other names
2-(4-Chloro-3,5-difluorophenyl)acetic acid 95% (CAS 1000566-17-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A637807-100mg |
| cas | 1000566-17-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 309.19 Pln | |
| Ambeed | 250mg | 420.44 Pln | |
| Ambeed | 1g | 1037.88 Pln | |
| Ambeed | 5g | 2906.88 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A637807 |
2-(4-chloro-3,5-difluorophenyl)acetic acid (CAS 1000566-17-5) is a chemical compound with the molecular formula C8H5ClF2O2 and a molecular weight of 206.57 g/mol. IUPAC name: 2-(4-chloro-3,5-difluorophenyl)acetic acid. InChIKey: DSNDWLRWEGZWDG-UHFFFAOYSA-N.
| Molecular formula | C8H5ClF2O2 |
|---|---|
| Molecular weight | 206.57 g/mol |
| IUPAC name | 2-(4-chloro-3,5-difluorophenyl)acetic acid |
| InChIKey | DSNDWLRWEGZWDG-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)Cl)F)CC(=O)O |
Computed by PubChem (NCBI)