CAS 886501-67-3 is the registry number for 2,3-Difluoro-6-methoxybenzoyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2,3-difluoro-6-methoxybenzoyl chloride (CAS 886501-67-3) is a chemical compound with the molecular formula C8H5ClF2O2 and a molecular weight of 206.57 g/mol. IUPAC name: 2,3-difluoro-6-methoxybenzoyl chloride. InChIKey: XYFNRGYOYWRUSY-UHFFFAOYSA-N.
| Molecular formula | C8H5ClF2O2 |
|---|---|
| Molecular weight | 206.57 g/mol |
| IUPAC name | 2,3-difluoro-6-methoxybenzoyl chloride |
| InChIKey | XYFNRGYOYWRUSY-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)F)F)C(=O)Cl |
Computed by PubChem (NCBI)