Products 886501-67-3

CAS 886501-67-3 is the registry number for 2,3-Difluoro-6-methoxybenzoyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

2,3-difluoro-6-methoxybenzoyl chloride (CAS 886501-67-3) is a chemical compound with the molecular formula C8H5ClF2O2 and a molecular weight of 206.57 g/mol. IUPAC name: 2,3-difluoro-6-methoxybenzoyl chloride. InChIKey: XYFNRGYOYWRUSY-UHFFFAOYSA-N.

Identity
Molecular formulaC8H5ClF2O2
Molecular weight206.57 g/mol
IUPAC name2,3-difluoro-6-methoxybenzoyl chloride
InChIKeyXYFNRGYOYWRUSY-UHFFFAOYSA-N
SMILESCOC1=C(C(=C(C=C1)F)F)C(=O)Cl

Computed by PubChem (NCBI)