CAS 476473-97-9 appears in our catalog under these names: 5-(Chloromethyl)-2,2-difluorobenzo[d][1,3]dioxole, 95%, 5–(Chloromethyl)–2,2–difluorobenzo(d)(1,3)dioxole, 5-(Chloromethyl)-2,2-difluorobenzo[d][1,3]dioxole, 95%, 95%, 5-(CHLOROMETHYL)-2,2-DIFLUOROBENZO[D][1,3]DIOXOLE, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 5g, 10g, 100mg.
5-(chloromethyl)-2,2-difluoro-1,3-benzodioxole (CAS 476473-97-9) is a chemical compound with the molecular formula C8H5ClF2O2 and a molecular weight of 206.57 g/mol. IUPAC name: 5-(chloromethyl)-2,2-difluoro-1,3-benzodioxole. InChIKey: TWIROCHBZRSMEC-UHFFFAOYSA-N.
| Molecular formula | C8H5ClF2O2 |
|---|---|
| Molecular weight | 206.57 g/mol |
| IUPAC name | 5-(chloromethyl)-2,2-difluoro-1,3-benzodioxole |
| InChIKey | TWIROCHBZRSMEC-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1CCl)OC(O2)(F)F |
Computed by PubChem (NCBI)