CAS 1214334-98-1 appears in our catalog under these names: Methyl 4-chloro-2,3-difluorobenzoate, 95%, Methyl 4-chloro-2,3-difluorobenzoate, ≥95%, ≥95%, Methyl 4-chloro-2,3-difluorobenzoate, ≥95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 5g.
Methyl 4-chloro-2,3-difluorobenzoate (CAS 1214334-98-1) is a chemical compound with the molecular formula C8H5ClF2O2 and a molecular weight of 206.57 g/mol. IUPAC name: methyl 4-chloro-2,3-difluorobenzoate. InChIKey: LVPFZWHSCSDSKZ-UHFFFAOYSA-N.
| Molecular formula | C8H5ClF2O2 |
|---|---|
| Molecular weight | 206.57 g/mol |
| IUPAC name | methyl 4-chloro-2,3-difluorobenzoate |
| InChIKey | LVPFZWHSCSDSKZ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=C(C=C1)Cl)F)F |
Computed by PubChem (NCBI)