Products 57320-63-5
CAS 57320-63-5 is the registry number for 4-(Difluoromethoxy)benzoyl chloride, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
4-(difluoromethoxy)benzoyl chloride (CAS 57320-63-5) is a chemical compound with the molecular formula C8H5ClF2O2 and a molecular weight of 206.57 g/mol. IUPAC name: 4-(difluoromethoxy)benzoyl chloride. InChIKey: BRXHGTQXWFFHMM-UHFFFAOYSA-N.
| Molecular formula | C8H5ClF2O2 |
|---|---|
| Molecular weight | 206.57 g/mol |
| IUPAC name | 4-(difluoromethoxy)benzoyl chloride |
| InChIKey | BRXHGTQXWFFHMM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)Cl)OC(F)F |
Computed by PubChem (NCBI)