CAS 1000566-17-5 appears in our catalog under these names: 4-Chloro-3,5-difluorophenylacetic acid, 95%, 4-Chloro-3,5-difluorophenylacetic acid, 2-(4-Chloro-3,5-difluorophenyl)acetic acid, 95%. Offered by: Combi-blocks, Biosynth, Ambeed. Available pack sizes: 1g, 5g, 10g, 0,5g, 100mg, 250mg.
2-(4-chloro-3,5-difluorophenyl)acetic acid (CAS 1000566-17-5) is a chemical compound with the molecular formula C8H5ClF2O2 and a molecular weight of 206.57 g/mol. IUPAC name: 2-(4-chloro-3,5-difluorophenyl)acetic acid. InChIKey: DSNDWLRWEGZWDG-UHFFFAOYSA-N.
| Molecular formula | C8H5ClF2O2 |
|---|---|
| Molecular weight | 206.57 g/mol |
| IUPAC name | 2-(4-chloro-3,5-difluorophenyl)acetic acid |
| InChIKey | DSNDWLRWEGZWDG-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)Cl)F)CC(=O)O |
Computed by PubChem (NCBI)