CAS 773869-46-8 appears in our catalog under these names: 5-Chloro-2,3-difluoro-4-methylbenzoic acid, 95%, 5-Chloro-2,3-difluoro-4-methylbenzoic acid, 95%, 95%, 5-Chloro-2,3-difluoro-4-methylbenzoic acid, >=95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
5-chloro-2,3-difluoro-4-methylbenzoic acid (CAS 773869-46-8) is a chemical compound with the molecular formula C8H5ClF2O2 and a molecular weight of 206.57 g/mol. IUPAC name: 5-chloro-2,3-difluoro-4-methylbenzoic acid. InChIKey: XNUGHWYSXYFWKR-UHFFFAOYSA-N.
| Molecular formula | C8H5ClF2O2 |
|---|---|
| Molecular weight | 206.57 g/mol |
| IUPAC name | 5-chloro-2,3-difluoro-4-methylbenzoic acid |
| InChIKey | XNUGHWYSXYFWKR-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C(=C1F)F)C(=O)O)Cl |
Computed by PubChem (NCBI)