CAS 1879026-06-8 is the registry number for 4-Chloro-2,3-difluoro-5-methoxybenzaldehyde, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g, 250mg.
4-chloro-2,3-difluoro-5-methoxybenzaldehyde (CAS 1879026-06-8) is a chemical compound with the molecular formula C8H5ClF2O2 and a molecular weight of 206.57 g/mol. IUPAC name: 4-chloro-2,3-difluoro-5-methoxybenzaldehyde. InChIKey: MMVKNQVXCPGQLL-UHFFFAOYSA-N.
| Molecular formula | C8H5ClF2O2 |
|---|---|
| Molecular weight | 206.57 g/mol |
| IUPAC name | 4-chloro-2,3-difluoro-5-methoxybenzaldehyde |
| InChIKey | MMVKNQVXCPGQLL-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C(=C1)C=O)F)F)Cl |
Computed by PubChem (NCBI)