CAS 948833-74-7 appears in our catalog under these names: Methyl 3-chloro-2,4-difluorobenzoate, 95%, Methyl 3-Chloro-2,4-difluorobenzoate. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 2,5g.
Methyl 3-chloro-2,4-difluorobenzoate (CAS 948833-74-7) is a chemical compound with the molecular formula C8H5ClF2O2 and a molecular weight of 206.57 g/mol. IUPAC name: methyl 3-chloro-2,4-difluorobenzoate. InChIKey: GKYHTALZVVERSW-UHFFFAOYSA-N.
| Molecular formula | C8H5ClF2O2 |
|---|---|
| Molecular weight | 206.57 g/mol |
| IUPAC name | methyl 3-chloro-2,4-difluorobenzoate |
| InChIKey | GKYHTALZVVERSW-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=C(C=C1)F)Cl)F |
Computed by PubChem (NCBI)