CAS 221221-11-0 appears in our catalog under these names: 2,4-Difluoro-3-methoxybenzoyl chloride, 95%, 2,4-Difluoro-3-methoxybenzoyl chloride, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 25g.
2,4-difluoro-3-methoxybenzoyl chloride (CAS 221221-11-0) is a chemical compound with the molecular formula C8H5ClF2O2 and a molecular weight of 206.57 g/mol. IUPAC name: 2,4-difluoro-3-methoxybenzoyl chloride. InChIKey: MCYMWQNLWOAEMH-UHFFFAOYSA-N.
| Molecular formula | C8H5ClF2O2 |
|---|---|
| Molecular weight | 206.57 g/mol |
| IUPAC name | 2,4-difluoro-3-methoxybenzoyl chloride |
| InChIKey | MCYMWQNLWOAEMH-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1F)C(=O)Cl)F |
Computed by PubChem (NCBI)