CAS 537033-55-9 appears in our catalog under these names: 4-Chloro-2,6-difluorophenylacetic acid, 95%, 2-(4-Chloro-2,6-difluorophenyl)acetic acid, 98+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 10g, 100mg.
2-(4-chloro-2,6-difluorophenyl)acetic acid (CAS 537033-55-9) is a chemical compound with the molecular formula C8H5ClF2O2 and a molecular weight of 206.57 g/mol. IUPAC name: 2-(4-chloro-2,6-difluorophenyl)acetic acid. InChIKey: LITZKYPXFPYSOE-UHFFFAOYSA-N.
| Molecular formula | C8H5ClF2O2 |
|---|---|
| Molecular weight | 206.57 g/mol |
| IUPAC name | 2-(4-chloro-2,6-difluorophenyl)acetic acid |
| InChIKey | LITZKYPXFPYSOE-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)CC(=O)O)F)Cl |
Computed by PubChem (NCBI)