CAS 1261802-94-1 appears in our catalog under these names: Methyl 5-chloro-2,4-difluorobenzoate, 98%, Methyl 5-chloro-2,4-difluorobenzoate, 98%, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 10g, 25g, 100mg.
Methyl 5-chloro-2,4-difluorobenzoate (CAS 1261802-94-1) is a chemical compound with the molecular formula C8H5ClF2O2 and a molecular weight of 206.57 g/mol. IUPAC name: methyl 5-chloro-2,4-difluorobenzoate. InChIKey: XYMSJOLPHIRLNX-UHFFFAOYSA-N.
| Molecular formula | C8H5ClF2O2 |
|---|---|
| Molecular weight | 206.57 g/mol |
| IUPAC name | methyl 5-chloro-2,4-difluorobenzoate |
| InChIKey | XYMSJOLPHIRLNX-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1F)F)Cl |
Computed by PubChem (NCBI)