CAS 1706446-43-6 appears in our catalog under these names: 6-Chloro-2,4-difluoro-3-methylbenzoic acid, 95%, 6-Chloro-2,4-difluoro-3-methylbenzoic acid, 98%, 6-Chloro-2,4-difluoro-3-methylbenzoic acid, 95%, 95%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 250mg, 1g, 50mg, 100mg.
6-chloro-2,4-difluoro-3-methylbenzoic acid (CAS 1706446-43-6) is a chemical compound with the molecular formula C8H5ClF2O2 and a molecular weight of 206.57 g/mol. IUPAC name: 6-chloro-2,4-difluoro-3-methylbenzoic acid. InChIKey: GOWZQYJWODLKSX-UHFFFAOYSA-N.
| Molecular formula | C8H5ClF2O2 |
|---|---|
| Molecular weight | 206.57 g/mol |
| IUPAC name | 6-chloro-2,4-difluoro-3-methylbenzoic acid |
| InChIKey | GOWZQYJWODLKSX-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1F)Cl)C(=O)O)F |
Computed by PubChem (NCBI)