3,5-Difluoro-2-nitrobenzoic acid, 96%
cas: 331765-71-0 — see every product listed under this CAS number, including other names
3,5-Difluoro-2-nitrobenzoic acid, 96% (CAS 331765-71-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 250mg. Offered by: Fluorochem, Ambeed, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F033202-1G |
| cas | 331765-71-0 |
| size | 1g |
| availability | In Stock Germany |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 206.20 Pln | |
| Fluorochem | 5g | 497.76 Pln | |
| Fluorochem | 10g | 924.69 Pln | |
| Ambeed | 250mg | 153.44 Pln | |
| Ambeed | 1g | 192.38 Pln | |
| Ambeed | 5g | 442.69 Pln | |
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 1g | 136.40 Pln | |
| Chemat | 5g | 386.00 Pln | |
| Chemat | 10g | 683.60 Pln |
properties
| purity | 96% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 5-10 days |
| category | Odczynniki chemiczne |
3,5-difluoro-2-nitrobenzoic acid (CAS 331765-71-0) is a chemical compound with the molecular formula C7H3F2NO4 and a molecular weight of 203.10 g/mol. IUPAC name: 3,5-difluoro-2-nitrobenzoic acid. InChIKey: ZBEWIPTYUHHZIS-UHFFFAOYSA-N.
| Molecular formula | C7H3F2NO4 |
|---|---|
| Molecular weight | 203.10 g/mol |
| IUPAC name | 3,5-difluoro-2-nitrobenzoic acid |
| InChIKey | ZBEWIPTYUHHZIS-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(=O)O)[N+](=O)[O-])F)F |
Computed by PubChem (NCBI)