cas: 1520538-81-1 — see every product listed under this CAS number, including other names
3-Bromo-2,5-difluorobenzoic acid, 97%, 97% (CAS 1520538-81-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HXXO-100mg |
| cas | 1520538-81-1 |
| size | 100mg |
| availability | 125g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 136.40 Pln | |
| Chemat | 250mg | 165.20 Pln | |
| Chemat | 1g | 285.20 Pln | |
| Chemat | 5g | 736.40 Pln | |
| Chemat | 25g | 2469.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
3-bromo-2,5-difluorobenzoic acid (CAS 1520538-81-1) is a chemical compound with the molecular formula C7H3BrF2O2 and a molecular weight of 237.00 g/mol. IUPAC name: 3-bromo-2,5-difluorobenzoic acid. InChIKey: SRZCLFLALXTCLA-UHFFFAOYSA-N.
| Molecular formula | C7H3BrF2O2 |
|---|---|
| Molecular weight | 237.00 g/mol |
| IUPAC name | 3-bromo-2,5-difluorobenzoic acid |
| InChIKey | SRZCLFLALXTCLA-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(=O)O)F)Br)F |
Computed by PubChem (NCBI)