Products 2010955-48-1
CAS 2010955-48-1 is the registry number for 6-Bromo-2,3-difluoro-4-hydroxybenzaldehyde, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
6-bromo-2,3-difluoro-4-hydroxybenzaldehyde (CAS 2010955-48-1) is a chemical compound with the molecular formula C7H3BrF2O2 and a molecular weight of 237.00 g/mol. IUPAC name: 6-bromo-2,3-difluoro-4-hydroxybenzaldehyde. InChIKey: YRUSYULQLGSEGN-UHFFFAOYSA-N.
| Molecular formula | C7H3BrF2O2 |
|---|---|
| Molecular weight | 237.00 g/mol |
| IUPAC name | 6-bromo-2,3-difluoro-4-hydroxybenzaldehyde |
| InChIKey | YRUSYULQLGSEGN-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Br)C=O)F)F)O |
Computed by PubChem (NCBI)