CAS 28314-81-0 appears in our catalog under these names: 3-Bromo-2,6-difluorobenzoic acid, 97%, 97%, 3-Bromo-2,6-difluorobenzoic acid, 97%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g.
3-bromo-2,6-difluorobenzoic acid (CAS 28314-81-0) is a chemical compound with the molecular formula C7H3BrF2O2 and a molecular weight of 237.00 g/mol. IUPAC name: 3-bromo-2,6-difluorobenzoic acid. InChIKey: WEBVJSPIUIPJKV-UHFFFAOYSA-N.
| Molecular formula | C7H3BrF2O2 |
|---|---|
| Molecular weight | 237.00 g/mol |
| IUPAC name | 3-bromo-2,6-difluorobenzoic acid |
| InChIKey | WEBVJSPIUIPJKV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1F)C(=O)O)F)Br |
Computed by PubChem (NCBI)