CAS 28314-82-1 appears in our catalog under these names: 4-bromo-2,5-difluorobenzoic Acid, 4-Bromo-2,5-difluorobenzoic acid, 98%, 98%, 4-Bromo-2,5-difluorobenzoic acid, 95%, 4-Bromo-2,5-difluorobenzoic acid, 97%. Offered by: Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 0,1kg, 0,25kg, 0,5kg, 250g, 250mg, 1g, 5g, 10g.
4-bromo-2,5-difluorobenzoic acid (CAS 28314-82-1) is a chemical compound with the molecular formula C7H3BrF2O2 and a molecular weight of 237.00 g/mol. IUPAC name: 4-bromo-2,5-difluorobenzoic acid. InChIKey: YWZSTHLOAZTDFJ-UHFFFAOYSA-N.
| Molecular formula | C7H3BrF2O2 |
|---|---|
| Molecular weight | 237.00 g/mol |
| IUPAC name | 4-bromo-2,5-difluorobenzoic acid |
| InChIKey | YWZSTHLOAZTDFJ-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)Br)F)C(=O)O |
Computed by PubChem (NCBI)