CAS 64695-84-7 appears in our catalog under these names: 2–Bromo–4,5–difluorobenzoic acid, 2-Bromo-4,5-difluorobenzoic Acid, >98.0%(GC)(T), 2-Bromo-4,5-difluorobenzoic acid, 97%, 2-Bromo-4,5-difluorobenzoic acid, 99.93%, 2-Bromo-4,5-difluorobenzoic acid 98%. Offered by: GLPBio, TCI, Thermo Scientific (Acros), MedChemExpress, Fluorochem. Available pack sizes: 25g, 5g, 25 g, 10 g, 10g, 100g, 500g, 1kg.
2-bromo-4,5-difluorobenzoic acid (CAS 64695-84-7) is a chemical compound with the molecular formula C7H3BrF2O2 and a molecular weight of 237.00 g/mol. IUPAC name: 2-bromo-4,5-difluorobenzoic acid. InChIKey: DGCBGBZYTNTZJH-UHFFFAOYSA-N.
| Molecular formula | C7H3BrF2O2 |
|---|---|
| Molecular weight | 237.00 g/mol |
| IUPAC name | 2-bromo-4,5-difluorobenzoic acid |
| InChIKey | DGCBGBZYTNTZJH-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)F)Br)C(=O)O |
Computed by PubChem (NCBI)