CAS 651026-99-2 appears in our catalog under these names: 2-Bromo-4,6-difluorobenzoic acid, 2-Bromo-4,6-difluorobenzoic acid, 95%, 2-Bromo-4,6-difluorobenzoic acid 98%, 2-Bromo-4,6-difluorobenzoic acid, 98%, 98%. Offered by: Biosynth, Combi-blocks, Ambeed, Fluorochem, Chemat. Available pack sizes: 2,5g, 5g, 1g, 10g, 100mg, 250mg, 25g.
2-bromo-4,6-difluorobenzoic acid (CAS 651026-99-2) is a chemical compound with the molecular formula C7H3BrF2O2 and a molecular weight of 237.00 g/mol. IUPAC name: 2-bromo-4,6-difluorobenzoic acid. InChIKey: GKYHVDQTGWPNBP-UHFFFAOYSA-N.
| Molecular formula | C7H3BrF2O2 |
|---|---|
| Molecular weight | 237.00 g/mol |
| IUPAC name | 2-bromo-4,6-difluorobenzoic acid |
| InChIKey | GKYHVDQTGWPNBP-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)C(=O)O)Br)F |
Computed by PubChem (NCBI)