CAS 1244642-73-6 appears in our catalog under these names: 3-Bromo-4,5-difluorobenzoic acid, 98%, 3-Bromo-4,5-difluorobenzoic Acid, 3-Bromo-4,5-difluorobenzoic acid 97%, 3-Bromo-4,5-difluorobenzoic acid, 97%, 97%, 3-BROMO-4,5-DIFLUOROBENZOIC ACID, 97%. Offered by: Combi-blocks, TRC, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 5g, 25g, 250mg, 100g, 100mg.
3-bromo-4,5-difluorobenzoic acid (CAS 1244642-73-6) is a chemical compound with the molecular formula C7H3BrF2O2 and a molecular weight of 237.00 g/mol. IUPAC name: 3-bromo-4,5-difluorobenzoic acid. InChIKey: PBUNICLVOHJWRN-UHFFFAOYSA-N.
| Molecular formula | C7H3BrF2O2 |
|---|---|
| Molecular weight | 237.00 g/mol |
| IUPAC name | 3-bromo-4,5-difluorobenzoic acid |
| InChIKey | PBUNICLVOHJWRN-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)F)Br)C(=O)O |
Computed by PubChem (NCBI)