CAS 183065-68-1 appears in our catalog under these names: 4–Bromo–2,6–difluorobenzoic acid, 4-Bromo-2,6-difluorobenzoic acid, 4-Bromo-2,6-difluorobenzoic Acid, >98.0%(GC)(T), 4-Bromo-2,6-difluorobenzoic acid, 98%, 98%, 4-Bromo-2,6-difluorobenzoic acid, 98%. Offered by: GLPBio, Biosynth, TCI, Chemat, Fluorochem. Available pack sizes: 100g, 25g, 500g, 0,1kg, 1g, 5g, 10g, 1kg.
4-bromo-2,6-difluorobenzoic acid (CAS 183065-68-1) is a chemical compound with the molecular formula C7H3BrF2O2 and a molecular weight of 237.00 g/mol. IUPAC name: 4-bromo-2,6-difluorobenzoic acid. InChIKey: IRHPJGPQWZEZRX-UHFFFAOYSA-N.
| Molecular formula | C7H3BrF2O2 |
|---|---|
| Molecular weight | 237.00 g/mol |
| IUPAC name | 4-bromo-2,6-difluorobenzoic acid |
| InChIKey | IRHPJGPQWZEZRX-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)C(=O)O)F)Br |
Computed by PubChem (NCBI)