CAS 1520538-81-1 appears in our catalog under these names: 3-Bromo-2,5-difluorobenzoic acid, 98%, 3-bromo-2,5-difluorobenzoic acid, 3-Bromo-2,5-difluorobenzoic acid, 97%, 97%, 3-Bromo-2,5-difluorobenzoic acid, 97%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 10g, 5g, 1g, 2,5g, 100mg, 25g.
3-bromo-2,5-difluorobenzoic acid (CAS 1520538-81-1) is a chemical compound with the molecular formula C7H3BrF2O2 and a molecular weight of 237.00 g/mol. IUPAC name: 3-bromo-2,5-difluorobenzoic acid. InChIKey: SRZCLFLALXTCLA-UHFFFAOYSA-N.
| Molecular formula | C7H3BrF2O2 |
|---|---|
| Molecular weight | 237.00 g/mol |
| IUPAC name | 3-bromo-2,5-difluorobenzoic acid |
| InChIKey | SRZCLFLALXTCLA-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(=O)O)F)Br)F |
Computed by PubChem (NCBI)