CAS 651027-01-9 appears in our catalog under these names: 2-Bromo-3,5-difluorobenzoic acid, 97%, 97%, 2-Bromo-3,5-difluorobenzoic acid, 96%, 2-Bromo-3,5-difluorobenzoic acid, 98%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 500g, 1g, 5g, 10g, 25g, 100g, 250mg.
2-bromo-3,5-difluorobenzoic acid (CAS 651027-01-9) is a chemical compound with the molecular formula C7H3BrF2O2 and a molecular weight of 237.00 g/mol. IUPAC name: 2-bromo-3,5-difluorobenzoic acid. InChIKey: KBOFTBQUYXDFEF-UHFFFAOYSA-N.
| Molecular formula | C7H3BrF2O2 |
|---|---|
| Molecular weight | 237.00 g/mol |
| IUPAC name | 2-bromo-3,5-difluorobenzoic acid |
| InChIKey | KBOFTBQUYXDFEF-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(=O)O)Br)F)F |
Computed by PubChem (NCBI)