CAS 651027-00-8 appears in our catalog under these names: 4-Bromo-3,5-difluorobenzoic acid, 96%, 4–Bromo–3,5–difluorobenzoic acid, 4-Bromo-3,5-difluorobenzoic acid, 96% , 4-Bromo-3,5-difluorobenzoic acid, 4-Bromo-3,5-difluorobenzoic acid, 97%, 97%. Offered by: Combi-blocks, GLPBio, Thermo Scientific (Alfa Aesar), Biosynth, Chemat. Available pack sizes: 25g, 1g, 100g, 10g, 5g, 100mg, 250mg, 50g.
4-bromo-3,5-difluorobenzoic acid (CAS 651027-00-8) is a chemical compound with the molecular formula C7H3BrF2O2 and a molecular weight of 237.00 g/mol. IUPAC name: 4-bromo-3,5-difluorobenzoic acid. InChIKey: NLLRAEQVOZOSBB-UHFFFAOYSA-N.
| Molecular formula | C7H3BrF2O2 |
|---|---|
| Molecular weight | 237.00 g/mol |
| IUPAC name | 4-bromo-3,5-difluorobenzoic acid |
| InChIKey | NLLRAEQVOZOSBB-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)Br)F)C(=O)O |
Computed by PubChem (NCBI)